CymitQuimica logo

CAS 1187167-84-5

:

4-(4-Isoquinolinylcarbonyl)benzonitrile

Description:
4-(4-Isoquinolinylcarbonyl)benzonitrile, identified by its CAS number 1187167-84-5, is a chemical compound characterized by its unique structural features, which include a benzonitrile moiety and an isoquinoline-derived carbonyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for π-π stacking interactions due to its conjugated system. The presence of the nitrile group contributes to its polarity and can influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic additions. Additionally, the isoquinoline structure may impart biological activity, suggesting potential applications in medicinal chemistry. The compound's solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, 4-(4-Isoquinolinylcarbonyl)benzonitrile represents a versatile scaffold for further chemical modifications and investigations in both synthetic and pharmaceutical chemistry.
Formula:C17H10N2O
InChI:InChI=1S/C17H10N2O/c18-9-12-5-7-13(8-6-12)17(20)16-11-19-10-14-3-1-2-4-15(14)16/h1-8,10-11H
InChI key:InChIKey=KMKIDWDINSQCIP-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=CC=C(C#N)C=C3
Synonyms:
  • 4-(4-Isoquinolinylcarbonyl)benzonitrile
  • Benzonitrile, 4-(4-isoquinolinylcarbonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.