CAS 1187167-87-8
:(2,6-Dimethoxyphenyl)(6-methyl-3-pyridinyl)methanone
Description:
(2,6-Dimethoxyphenyl)(6-methyl-3-pyridinyl)methanone, identified by its CAS number 1187167-87-8, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with two methoxy groups and a pyridine ring with a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methoxy groups can influence its solubility and polarity, making it more soluble in organic solvents. Additionally, the presence of the pyridine ring may impart basicity and contribute to the compound's biological activity, potentially making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific physical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C15H15NO3
InChI:InChI=1S/C15H15NO3/c1-10-7-8-11(9-16-10)15(17)14-12(18-2)5-4-6-13(14)19-3/h4-9H,1-3H3
InChI key:InChIKey=IQLKZYRWECPSNR-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=CC=C1OC)C=2C=CC(C)=NC2
Synonyms:- Methanone, (2,6-dimethoxyphenyl)(6-methyl-3-pyridinyl)-
- (2,6-Dimethoxyphenyl)(6-methyl-3-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.