CAS 1187167-90-3

(3,5-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone

Description:

(3,5-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone, identified by its CAS number 1187167-90-3, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with two methyl groups and a pyridine ring with a methyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and a tendency to engage in electrophilic substitution reactions. The presence of both the dimethylphenyl and pyridinyl moieties suggests potential for diverse chemical reactivity and interactions, making it of interest in various fields, including medicinal chemistry and materials science. Its molecular structure may contribute to specific biological activities, which could be explored in drug development. Additionally, the compound's solubility, melting point, and boiling point would depend on the specific conditions and solvents used, influencing its practical applications. Overall, (3,5-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone represents a versatile chemical entity with potential utility in research and industry.

Formula: C₁₅H₁₅NO

InChI: InChI=1S/C15H15NO/c1-10-6-11(2)8-13(7-10)15(17)14-9-16-5-4-12(14)3/h4-9H,1-3H3

InChI key: InChIKey=SYNZOXIYIIHPQS-UHFFFAOYSA-N

SMILES: C(=O)(C=1C(C)=CC=NC1)C2=CC(C)=CC(C)=C2

Synonyms:

• (3,5-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone
• Methanone, (3,5-dimethylphenyl)(4-methyl-3-pyridinyl)-