CymitQuimica logo

CAS 1187167-92-5

:

(3,5-Dimethoxyphenyl)(6-methyl-3-pyridinyl)methanone

Description:
(3,5-Dimethoxyphenyl)(6-methyl-3-pyridinyl)methanone, identified by its CAS number 1187167-92-5, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with two methoxy groups and a pyridine ring with a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methoxy groups can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. Additionally, the presence of the pyridine moiety may impart basicity and contribute to the compound's pharmacological profile. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of pharmaceuticals. The specific characteristics, including solubility, melting point, and reactivity, would depend on the compound's precise molecular interactions and the environment in which it is studied.
Formula:C15H15NO3
InChI:InChI=1S/C15H15NO3/c1-10-4-5-11(9-16-10)15(17)12-6-13(18-2)8-14(7-12)19-3/h4-9H,1-3H3
InChI key:InChIKey=XHHNTJRFEGPQLW-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC)=CC(OC)=C1)C=2C=CC(C)=NC2
Synonyms:
  • Methanone, (3,5-dimethoxyphenyl)(6-methyl-3-pyridinyl)-
  • (3,5-Dimethoxyphenyl)(6-methyl-3-pyridinyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.