CAS 1187167-96-9

(4-Methyl-3-pyridinyl)[2-(trifluoromethyl)phenyl]methanone

Description:

(4-Methyl-3-pyridinyl)[2-(trifluoromethyl)phenyl]methanone, identified by its CAS number 1187167-96-9, is an organic compound characterized by its complex structure, which includes a pyridine ring and a trifluoromethyl-substituted phenyl group. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the presence of the methyl group on the pyridine ring may affect the compound's electronic properties and steric hindrance. Overall, this compound's unique characteristics make it a subject of interest for further research, particularly in the fields of pharmaceuticals and agrochemicals, where such modifications can lead to enhanced efficacy and specificity in biological applications.

Formula: C₁₄H₁₀F₃NO

InChI: InChI=1S/C14H10F3NO/c1-9-6-7-18-8-11(9)13(19)10-4-2-3-5-12(10)14(15,16)17/h2-8H,1H3

InChI key: InChIKey=AUYICPPHLXMBIR-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C(F)(F)F)C=CC=C1)C=2C(C)=CC=NC2

Synonyms:

• (4-Methyl-3-pyridinyl)[2-(trifluoromethyl)phenyl]methanone
• Methanone, (4-methyl-3-pyridinyl)[2-(trifluoromethyl)phenyl]-