CAS 1187168-00-8
:(6-Chloro-3-pyridinyl)[3-(trifluoromethyl)phenyl]methanone
Description:
(6-Chloro-3-pyridinyl)[3-(trifluoromethyl)phenyl]methanone is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chlorine atom and a phenyl group that features a trifluoromethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group. The trifluoromethyl group is known for its electron-withdrawing properties, which can influence the compound's reactivity and interaction with biological targets. Additionally, the chlorine atom can affect the compound's lipophilicity and solubility in various solvents. Such characteristics make this compound of interest in medicinal chemistry and material science, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. Its specific applications and behavior would depend on the context of its use, including potential biological activity or utility in chemical reactions.
Formula:C13H7ClF3NO
InChI:InChI=1S/C13H7ClF3NO/c14-11-5-4-9(7-18-11)12(19)8-2-1-3-10(6-8)13(15,16)17/h1-7H
InChI key:InChIKey=HVZFAPOUXFVZBF-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C(F)(F)F)=CC=C1)C=2C=CC(Cl)=NC2
Synonyms:- Methanone, (6-chloro-3-pyridinyl)[3-(trifluoromethyl)phenyl]-
- (6-Chloro-3-pyridinyl)[3-(trifluoromethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.