CAS 1187168-05-3

(6-Chloro-3-pyridinyl)(3-fluorophenyl)methanone

Description:

(6-Chloro-3-pyridinyl)(3-fluorophenyl)methanone is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom at the 6-position and a phenyl group with a fluorine atom at the 3-position. This compound belongs to the class of ketones, specifically aryl ketones, and exhibits properties typical of such compounds, including potential reactivity due to the presence of the carbonyl group. The chlorine and fluorine substituents can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its biological activity. It may be of interest in medicinal chemistry for its potential applications in drug development, particularly in targeting specific biological pathways. The presence of halogens often contributes to the compound's stability and reactivity, making it a candidate for further investigation in various chemical and pharmaceutical contexts. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₇ClFNO

InChI: InChI=1S/C12H7ClFNO/c13-11-5-4-9(7-15-11)12(16)8-2-1-3-10(14)6-8/h1-7H

InChI key: InChIKey=IYZUHCHTQCSQEN-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC=C1)C=2C=CC(Cl)=NC2

Synonyms:

• 2-Chloro-5-(3-fluorobenzoyl)pyridine
• (6-Chloro-3-pyridinyl)(3-fluorophenyl)methanone
• (3-Fluorophenyl)(6-chloropyridin-3-yl)methanone
• Methanone, (6-chloro-3-pyridinyl)(3-fluorophenyl)-