CAS 1187168-11-1

(3-Chlorophenyl)(6-chloro-3-pyridinyl)methanone

Description:

(3-Chlorophenyl)(6-chloro-3-pyridinyl)methanone, identified by its CAS number 1187168-11-1, is a chemical compound characterized by its unique structure, which includes a chlorinated phenyl group and a chlorinated pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of halogen substituents. The chlorinated groups can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the ketone functional group contributes to its reactivity, allowing for potential interactions with nucleophiles. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, (3-Chlorophenyl)(6-chloro-3-pyridinyl)methanone represents a versatile structure in organic synthesis and drug development.

Formula: C₁₂H₇Cl₂NO

InChI: InChI=1S/C12H7Cl2NO/c13-10-3-1-2-8(6-10)12(16)9-4-5-11(14)15-7-9/h1-7H

InChI key: InChIKey=XTEHBOZQORDTAQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC=C1)C=2C=CC(Cl)=NC2

Synonyms:

• (3-Chlorophenyl)(6-chloropyridin-3-yl)methanone
• Methanone, (3-chlorophenyl)(6-chloro-3-pyridinyl)-
• 2-Chloro-5-(3-chlorobenzoyl)pyridine
• (3-Chlorophenyl)(6-chloro-3-pyridinyl)methanone