CymitQuimica logo

CAS 1187168-17-7

:

(6-Chloro-3-pyridinyl)(2,3-dichlorophenyl)methanone

Description:
(6-Chloro-3-pyridinyl)(2,3-dichlorophenyl)methanone, identified by its CAS number 1187168-17-7, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a dichlorophenyl moiety. This compound features a ketone functional group, contributing to its reactivity and potential applications in various chemical reactions. The presence of chlorine substituents enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and agrochemical research. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, its unique combination of functional groups may impart specific physical properties, such as solubility and stability, which are crucial for its application in formulations. Overall, (6-Chloro-3-pyridinyl)(2,3-dichlorophenyl)methanone represents a significant compound for further investigation in both synthetic and applied chemistry contexts.
Formula:C12H6Cl3NO
InChI:InChI=1S/C12H6Cl3NO/c13-9-3-1-2-8(11(9)15)12(17)7-4-5-10(14)16-6-7/h1-6H
InChI key:InChIKey=YPBSPNKDFGTFCW-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C(Cl)=CC=C1)C=2C=CC(Cl)=NC2
Synonyms:
  • Methanone, (6-chloro-3-pyridinyl)(2,3-dichlorophenyl)-
  • (6-Chloro-3-pyridinyl)(2,3-dichlorophenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.