CAS 1187168-19-9

(2,6-Dimethoxyphenyl)-4-isoquinolinylmethanone

Description:

(2,6-Dimethoxyphenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187168-19-9, is a chemical compound that features a complex structure combining a dimethoxy-substituted phenyl group and an isoquinoline moiety linked through a ketone functional group. This compound is characterized by its aromatic nature, which contributes to its stability and potential reactivity. The presence of methoxy groups enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for various applications in medicinal chemistry and material science. The isoquinoline structure suggests potential biological activity, as many isoquinoline derivatives are known for their pharmacological properties. Additionally, the compound's molecular configuration may allow for interactions with biological targets, making it of interest in drug discovery. Overall, (2,6-Dimethoxyphenyl)-4-isoquinolinylmethanone represents a unique scaffold that could be explored for its chemical reactivity and potential therapeutic applications.

Formula: C₁₈H₁₅NO₃

InChI: InChI=1S/C18H15NO3/c1-21-15-8-5-9-16(22-2)17(15)18(20)14-11-19-10-12-6-3-4-7-13(12)14/h3-11H,1-2H3

InChI key: InChIKey=ZTEHKLJIBVDHBF-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C=CC=C1OC)C=2C3=C(C=NC2)C=CC=C3

Synonyms:

• (2,6-Dimethoxyphenyl)-4-isoquinolinylmethanone
• Methanone, (2,6-dimethoxyphenyl)-4-isoquinolinyl-