CAS 1187168-20-2
:2-(4-Bromo-2-fluorophenyl)-6-methylpyridine
Description:
2-(4-Bromo-2-fluorophenyl)-6-methylpyridine is an organic compound characterized by its unique molecular structure, which includes a pyridine ring substituted with both a bromo and a fluoro group on the phenyl moiety. This compound features a methyl group at the 6-position of the pyridine ring, contributing to its overall hydrophobic character. The presence of halogen atoms, specifically bromine and fluorine, enhances its reactivity and potential for forming various chemical bonds, making it of interest in medicinal chemistry and material science. The compound's molecular formula reflects its complexity, and its physical properties, such as melting point and solubility, can vary based on the specific conditions and solvents used. Additionally, the presence of these substituents can influence the compound's electronic properties, potentially affecting its behavior in biological systems or its utility in synthetic applications. Overall, 2-(4-Bromo-2-fluorophenyl)-6-methylpyridine is a versatile compound with potential applications in various fields of chemistry.
Formula:C12H9BrFN
InChI:InChI=1S/C12H9BrFN/c1-8-3-2-4-12(15-8)10-6-5-9(13)7-11(10)14/h2-7H,1H3
InChI key:InChIKey=HWBLUWUWPWZXRV-UHFFFAOYSA-N
SMILES:FC1=C(C=2N=C(C)C=CC2)C=CC(Br)=C1
Synonyms:- Pyridine, 2-(4-bromo-2-fluorophenyl)-6-methyl-
- 2-(4-Bromo-2-fluorophenyl)-6-methylpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.