CAS 1187168-26-8

(3,4-Dimethoxyphenyl)-4-isoquinolinylmethanone

Description:

(3,4-Dimethoxyphenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187168-26-8, is a chemical compound that features a complex structure comprising a phenyl ring substituted with two methoxy groups and an isoquinoline moiety. This compound is characterized by its potential biological activity, which may include interactions with various biological targets, making it of interest in medicinal chemistry. The presence of methoxy groups typically enhances the lipophilicity and may influence the compound's pharmacokinetic properties. Additionally, the isoquinoline structure is known for its diverse range of biological activities, including antitumor and antimicrobial properties. The compound's synthesis may involve multi-step organic reactions, and its characterization can be performed using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy. Overall, (3,4-Dimethoxyphenyl)-4-isoquinolinylmethanone represents a class of compounds that could be explored for therapeutic applications, although specific studies would be necessary to elucidate its full biological profile and potential uses.

Formula: C₁₈H₁₅NO₃

InChI: InChI=1S/C18H15NO3/c1-21-16-8-7-12(9-17(16)22-2)18(20)15-11-19-10-13-5-3-4-6-14(13)15/h3-11H,1-2H3

InChI key: InChIKey=JVSKCTDKQKJNHE-UHFFFAOYSA-N

SMILES: C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=CC(OC)=C(OC)C=C3

Synonyms:

• Methanone, (3,4-dimethoxyphenyl)-4-isoquinolinyl-
• (3,4-Dimethoxyphenyl)-4-isoquinolinylmethanone