CymitQuimica logo

CAS 1187168-31-5

:

(3,5-Dimethoxyphenyl)(6-methoxy-2-pyridinyl)methanone

Description:
(3,5-Dimethoxyphenyl)(6-methoxy-2-pyridinyl)methanone, identified by its CAS number 1187168-31-5, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with two methoxy groups and a pyridine ring with a methoxy substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic systems, contributing to its potential biological activity. The presence of methoxy groups enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its molecular configuration may also impart specific reactivity patterns, making it of interest in synthetic organic chemistry. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical properties, which is crucial for understanding its potential applications in research and industry.
Formula:C15H15NO4
InChI:InChI=1S/C15H15NO4/c1-18-11-7-10(8-12(9-11)19-2)15(17)13-5-4-6-14(16-13)20-3/h4-9H,1-3H3
InChI key:InChIKey=DEUUYNYECFDUCX-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC)=CC(OC)=C1)C=2N=C(OC)C=CC2
Synonyms:
  • Methanone, (3,5-dimethoxyphenyl)(6-methoxy-2-pyridinyl)-
  • (3,5-Dimethoxyphenyl)(6-methoxy-2-pyridinyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.