CAS 1187168-34-8

(2,3-Difluorophenyl)(4-methyl-3-pyridinyl)methanone

Description:

(2,3-Difluorophenyl)(4-methyl-3-pyridinyl)methanone is an organic compound characterized by its complex structure, which includes a difluorophenyl group and a pyridinyl moiety. The presence of fluorine atoms in the difluorophenyl group enhances the compound's lipophilicity and may influence its biological activity. The methanone functional group indicates that it contains a carbonyl (C=O) group, which is typically associated with reactivity in various chemical reactions, including nucleophilic attacks. The pyridinyl component, derived from pyridine, contributes to the compound's potential for coordination with metal ions and its role in biological systems, particularly in medicinal chemistry. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its molecular structure suggests potential applications in areas such as agrochemicals or pharmaceuticals, where the specific arrangement of functional groups can significantly affect the compound's efficacy and interaction with biological targets.

Formula: C₁₃H₉F₂NO

InChI: InChI=1S/C13H9F2NO/c1-8-5-6-16-7-10(8)13(17)9-3-2-4-11(14)12(9)15/h2-7H,1H3

InChI key: InChIKey=HTNTXOLWFUWHPW-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C(F)=CC=C1)C=2C(C)=CC=NC2

Synonyms:

• (2,3-Difluorophenyl)(4-methyl-3-pyridinyl)methanone
• Methanone, (2,3-difluorophenyl)(4-methyl-3-pyridinyl)-