CAS 1187168-44-0

(6-Chloro-3-pyridinyl)(2,6-dimethoxyphenyl)methanone

Description:

(6-Chloro-3-pyridinyl)(2,6-dimethoxyphenyl)methanone is a chemical compound characterized by its complex structure, which includes a pyridine ring and a methanone functional group. The presence of the chloro substituent on the pyridine ring contributes to its reactivity and potential biological activity. The two methoxy groups on the phenyl ring enhance its lipophilicity, which can influence its solubility and interaction with biological membranes. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that can interact with various biological targets. Additionally, the presence of multiple functional groups suggests potential for diverse chemical reactivity, making it a candidate for further synthetic modifications. Its specific applications and biological activities would depend on ongoing research and characterization studies. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose health risks.

Formula: C₁₄H₁₂ClNO₃

InChI: InChI=1S/C14H12ClNO3/c1-18-10-4-3-5-11(19-2)13(10)14(17)9-6-7-12(15)16-8-9/h3-8H,1-2H3

InChI key: InChIKey=YSFPILJRWIKWBI-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C=CC=C1OC)C=2C=CC(Cl)=NC2

Synonyms:

• Methanone, (6-chloro-3-pyridinyl)(2,6-dimethoxyphenyl)-
• (6-Chloro-3-pyridinyl)(2,6-dimethoxyphenyl)methanone