CAS 1187168-78-0

(4-Methyl-3-pyridinyl)(4-phenoxyphenyl)methanone

Description:

(4-Methyl-3-pyridinyl)(4-phenoxyphenyl)methanone, identified by its CAS number 1187168-78-0, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl ether moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse chemical reactivity. The presence of the methyl group on the pyridine ring can influence its electronic properties, potentially enhancing its lipophilicity and biological activity. The phenoxyphenyl group contributes to the compound's overall hydrophobic character, which may affect its solubility in various solvents. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis.

Formula: C₁₉H₁₅NO₂

InChI: InChI=1S/C19H15NO2/c1-14-11-12-20-13-18(14)19(21)15-7-9-17(10-8-15)22-16-5-3-2-4-6-16/h2-13H,1H3

InChI key: InChIKey=SHHPVFNZHPEFGP-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OC2=CC=CC=C2)C=C1)C=3C(C)=CC=NC3

Synonyms:

• Methanone, (4-methyl-3-pyridinyl)(4-phenoxyphenyl)-
• (4-Methyl-3-pyridinyl)(4-phenoxyphenyl)methanone