CAS 1187168-85-9

(2,5-Difluorophenyl)(6-methyl-2-pyridinyl)methanone

Description:

(2,5-Difluorophenyl)(6-methyl-2-pyridinyl)methanone is an organic compound characterized by its complex structure, which includes a difluorophenyl group and a pyridinyl moiety. The presence of fluorine atoms in the phenyl ring enhances the compound's lipophilicity and may influence its biological activity. The methanone functional group indicates that it contains a carbonyl group (C=O) attached to a carbon atom that is also bonded to the two aromatic systems. This compound is likely to exhibit interesting chemical reactivity due to the electron-withdrawing nature of the fluorine atoms and the heterocyclic pyridine ring, which can participate in various chemical interactions. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can enhance efficacy or selectivity. Additionally, the compound's stability, solubility, and reactivity would depend on the specific conditions and solvents used in its handling and application. Overall, (2,5-Difluorophenyl)(6-methyl-2-pyridinyl)methanone represents a class of compounds that may be of significant interest in medicinal chemistry and material science.

Formula: C₁₃H₉F₂NO

InChI: InChI=1S/C13H9F2NO/c1-8-3-2-4-12(16-8)13(17)10-7-9(14)5-6-11(10)15/h2-7H,1H3

InChI key: InChIKey=AZRKEEFAJNDUOD-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=CC(F)=C1)C=2N=C(C)C=CC2

Synonyms:

• (2,5-Difluorophenyl)(6-methyl-2-pyridinyl)methanone
• Methanone, (2,5-difluorophenyl)(6-methyl-2-pyridinyl)-