CAS 1187168-93-9

[4-(1-Methylethoxy)phenyl](2-methyl-4-pyridinyl)methanone

Description:

The chemical substance known as [4-(1-Methylethoxy)phenyl](2-methyl-4-pyridinyl)methanone, with the CAS number 1187168-93-9, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with a methylethoxy group and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. It may display moderate to high lipophilicity, influencing its solubility in organic solvents and biological systems. The presence of the methanone functional group suggests potential reactivity in nucleophilic addition reactions. Additionally, the pyridine ring can contribute to the compound's basicity and potential interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique structural features may confer specific biological activities, warranting further investigation for applications in pharmaceuticals or agrochemicals.

Formula: C₁₆H₁₇NO₂

InChI: InChI=1S/C16H17NO2/c1-11(2)19-15-6-4-13(5-7-15)16(18)14-8-9-17-12(3)10-14/h4-11H,1-3H3

InChI key: InChIKey=QKXXPMPHCSHOQH-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C)N=CC1)C2=CC=C(OC(C)C)C=C2

Synonyms:

• [4-(1-Methylethoxy)phenyl](2-methyl-4-pyridinyl)methanone
• Methanone, [4-(1-methylethoxy)phenyl](2-methyl-4-pyridinyl)-