CAS 1187169-00-1
:(3-Bromophenyl)-4-isoquinolinylmethanone
Description:
(3-Bromophenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187169-00-1, is a chemical compound characterized by its unique structural features. It consists of a bromophenyl group attached to a methanone moiety, which is further linked to an isoquinoline structure. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the isoquinoline moiety, which is known for its pharmacological significance. The bromine substituent can influence the compound's reactivity and solubility, potentially enhancing its lipophilicity. In terms of applications, compounds of this nature may be explored in medicinal chemistry for their potential therapeutic effects, particularly in the development of new drugs. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, making it of interest in synthetic organic chemistry. Overall, (3-Bromophenyl)-4-isoquinolinylmethanone represents a versatile structure with implications in both research and application within the field of chemistry.
Formula:C16H10BrNO
InChI:InChI=1S/C16H10BrNO/c17-13-6-3-5-11(8-13)16(19)15-10-18-9-12-4-1-2-7-14(12)15/h1-10H
InChI key:InChIKey=BJAJGDVVIADVQB-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=CC(Br)=CC=C3
Synonyms:- (3-Bromophenyl)-4-isoquinolinylmethanone
- Methanone, (3-bromophenyl)-4-isoquinolinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.