CymitQuimica logo

CAS 1187169-23-8

:

(6-Chloro-3-pyridinyl)(3-phenoxyphenyl)methanone

Description:
(6-Chloro-3-pyridinyl)(3-phenoxyphenyl)methanone, identified by its CAS number 1187169-23-8, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenoxyphenyl moiety. The presence of a chlorine atom at the 6-position of the pyridine ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents, depending on the specific functional groups present. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components that can interact with biological targets. Additionally, the compound may possess specific pharmacological properties, making it of interest for further research in drug development. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C18H12ClNO2
InChI:InChI=1S/C18H12ClNO2/c19-17-10-9-14(12-20-17)18(21)13-5-4-8-16(11-13)22-15-6-2-1-3-7-15/h1-12H
InChI key:InChIKey=RHKPZUGEBGUYTA-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC2=CC=CC=C2)=CC=C1)C=3C=CC(Cl)=NC3
Synonyms:
  • Methanone, (6-chloro-3-pyridinyl)(3-phenoxyphenyl)-
  • (6-Chloro-3-pyridinyl)(3-phenoxyphenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.