CAS 1187169-28-3

[4-(1,1-Dimethylethyl)phenyl](6-methyl-3-pyridinyl)methanone

Description:

The chemical substance known as [4-(1,1-Dimethylethyl)phenyl](6-methyl-3-pyridinyl)methanone, with the CAS number 1187169-28-3, is an organic compound characterized by its complex structure that includes a phenyl group substituted with a tert-butyl group and a pyridine moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the tert-butyl group enhances its hydrophobic characteristics, while the pyridine ring introduces basicity and potential for coordination with metal ions. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various interactions, including hydrogen bonding and π-π stacking, which are significant in biological systems. Additionally, the compound's stability and solubility characteristics would depend on the specific conditions, such as solvent polarity and temperature. Overall, this substance represents a class of compounds that may have diverse applications in medicinal chemistry and material science.

Formula: C₁₇H₁₉NO

InChI: InChI=1S/C17H19NO/c1-12-5-6-14(11-18-12)16(19)13-7-9-15(10-8-13)17(2,3)4/h5-11H,1-4H3

InChI key: InChIKey=FDJIOZMNZXXINQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C(C)(C)C)C=C1)C=2C=CC(C)=NC2

Synonyms:

• [4-(1,1-Dimethylethyl)phenyl](6-methyl-3-pyridinyl)methanone
• Methanone, [4-(1,1-dimethylethyl)phenyl](6-methyl-3-pyridinyl)-

5-(4-tert-Butylbenzoyl)-2-methylpyridine

CAS: 1187169-28-3

Formula: C₁₇H₁₉NO

Purity: 97.0%

Molecular weight: 253.345

Ref: 10-F203419