CAS 1187169-32-9

(6-Chloro-3-pyridinyl)[4-(1-methylethyl)phenyl]methanone

Description:

(6-Chloro-3-pyridinyl)[4-(1-methylethyl)phenyl]methanone, identified by its CAS number 1187169-32-9, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chlorine atom and a ketone functional group. The presence of the isopropyl group on the phenyl ring contributes to its hydrophobic characteristics, influencing its solubility and reactivity. This compound is likely to exhibit biological activity due to its structural features, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the chlorine substituent may enhance the compound's lipophilicity and stability, affecting its pharmacokinetic properties. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₅H₁₄ClNO

InChI: InChI=1S/C15H14ClNO/c1-10(2)11-3-5-12(6-4-11)15(18)13-7-8-14(16)17-9-13/h3-10H,1-2H3

InChI key: InChIKey=XQMWNZRFDHVMQE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C(C)C)C=C1)C=2C=CC(Cl)=NC2

Synonyms:

• Methanone, (6-chloro-3-pyridinyl)[4-(1-methylethyl)phenyl]-
• (6-Chloro-3-pyridinyl)[4-(1-methylethyl)phenyl]methanone