CAS 1187169-43-2

[4-(1,1-Dimethylethyl)phenyl](2-methyl-4-pyridinyl)methanone

Description:

The chemical substance known as [4-(1,1-Dimethylethyl)phenyl](2-methyl-4-pyridinyl)methanone, with the CAS number 1187169-43-2, is an organic compound characterized by its complex structure that includes a phenyl group substituted with a tert-butyl group and a pyridine moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the tert-butyl group enhances its steric bulk, potentially influencing its interactions with other molecules. The pyridine ring adds to the compound's aromatic character and may impart specific electronic properties, making it of interest in medicinal chemistry and material science. Additionally, the compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, this substance may exhibit unique biological activities or serve as a precursor in synthetic pathways, warranting further investigation for its potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₇H₁₉NO

InChI: InChI=1S/C17H19NO/c1-12-11-14(9-10-18-12)16(19)13-5-7-15(8-6-13)17(2,3)4/h5-11H,1-4H3

InChI key: InChIKey=UNQLYKFGBYSCES-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C)N=CC1)C2=CC=C(C(C)(C)C)C=C2

Synonyms:

• [4-(1,1-Dimethylethyl)phenyl](2-methyl-4-pyridinyl)methanone
• Methanone, [4-(1,1-dimethylethyl)phenyl](2-methyl-4-pyridinyl)-

4-(4-tert-Butylbenzoyl)-2-methylpyridine

CAS: 1187169-43-2

Formula: C₁₇H₁₉NO

Purity: 97.0%

Molecular weight: 253.345

Ref: 10-F203486