CymitQuimica logo

CAS 1187169-45-4

:

(6-Chloro-3-pyridinyl)(4-hexylphenyl)methanone

Description:
(6-Chloro-3-pyridinyl)(4-hexylphenyl)methanone, identified by its CAS number 1187169-45-4, is a chemical compound characterized by its unique structural features. It contains a pyridine ring substituted with a chlorine atom at the 6-position and a ketone functional group linked to a phenyl ring that is further substituted with a hexyl group at the para position. This structure contributes to its potential biological activity and solubility properties. The presence of the chlorinated pyridine moiety may influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the hexylphenyl group enhances its lipophilicity, which can affect its pharmacokinetics and bioavailability. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, and its applications may span across fields such as pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and biological activity. Further studies would be necessary to elucidate its full potential and applications.
Formula:C18H20ClNO
InChI:InChI=1S/C18H20ClNO/c1-2-3-4-5-6-14-7-9-15(10-8-14)18(21)16-11-12-17(19)20-13-16/h7-13H,2-6H2,1H3
InChI key:InChIKey=PJIMRMCHSNTKKM-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CCCCCC)C=C1)C=2C=CC(Cl)=NC2
Synonyms:
  • Methanone, (6-chloro-3-pyridinyl)(4-hexylphenyl)-
  • (6-Chloro-3-pyridinyl)(4-hexylphenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.