CAS 1187169-48-7

[4-(Hexyloxy)phenyl](2-methyl-4-pyridinyl)methanone

Description:

[4-(Hexyloxy)phenyl](2-methyl-4-pyridinyl)methanone, with the CAS number 1187169-48-7, is an organic compound characterized by its complex molecular structure, which includes a phenyl group substituted with a hexyloxy chain and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse reactivity due to the presence of functional groups. The hexyloxy group contributes to its hydrophobic characteristics, while the pyridinyl group may impart basicity and potential for coordination with metal ions. Its molecular design suggests potential applications in pharmaceuticals, materials science, or as a ligand in coordination chemistry. The compound's solubility, melting point, and other physical properties would depend on its specific interactions with solvents and other substances, making it important to consider these factors in practical applications. Overall, this compound exemplifies the versatility of organic molecules in various chemical contexts.

Formula: C₁₉H₂₃NO₂

InChI: InChI=1S/C19H23NO2/c1-3-4-5-6-13-22-18-9-7-16(8-10-18)19(21)17-11-12-20-15(2)14-17/h7-12,14H,3-6,13H2,1-2H3

InChI key: InChIKey=CJFYRWRPYOGIBC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OCCCCCC)C=C1)C=2C=C(C)N=CC2

Synonyms:

• Methanone, [4-(hexyloxy)phenyl](2-methyl-4-pyridinyl)-
• [4-(Hexyloxy)phenyl](2-methyl-4-pyridinyl)methanone

4-(4-Hexyloxybenzoyl)-2-methylpyridine

CAS: 1187169-48-7

Formula: C₁₉H₂₃NO₂

Purity: 97.0%

Molecular weight: 297.398

Ref: 10-F203497