CAS 1187169-54-5

(3-Bromophenyl)(2-methyl-4-pyridinyl)methanone

Description:

(3-Bromophenyl)(2-methyl-4-pyridinyl)methanone, with the CAS number 1187169-54-5, is an organic compound characterized by its complex structure, which includes a bromophenyl group and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the bromine atom, which can influence its electronic properties and reactivity patterns. The ketone functional group in the structure contributes to its chemical reactivity, allowing for potential participation in nucleophilic addition reactions. Additionally, the presence of the pyridine ring may impart basicity and influence solubility in various solvents. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing other complex molecules. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the purity and specific conditions under which it is studied.

Formula: C₁₃H₁₀BrNO

InChI: InChI=1S/C13H10BrNO/c1-9-7-11(5-6-15-9)13(16)10-3-2-4-12(14)8-10/h2-8H,1H3

InChI key: InChIKey=CQRQMCDTKOZJEW-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Br)=CC=C1)C=2C=C(C)N=CC2

Synonyms:

• (3-Bromophenyl)(2-methyl-4-pyridinyl)methanone
• Methanone, (3-bromophenyl)(2-methyl-4-pyridinyl)-