CAS 1187169-57-8

(2-Iodophenyl)(2-methyl-4-pyridinyl)methanone

Description:

(2-Iodophenyl)(2-methyl-4-pyridinyl)methanone, with the CAS number 1187169-57-8, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with iodine and a pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group. The iodine atom can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The pyridine moiety contributes to the compound's basicity and can participate in coordination with metal ions. Additionally, the presence of the carbonyl group suggests potential applications in organic synthesis and medicinal chemistry, where such compounds may exhibit biological activity. Overall, this compound's unique structural features may lend it utility in research and development within the fields of pharmaceuticals and materials science.

Formula: C₁₃H₁₀INO

InChI: InChI=1S/C13H10INO/c1-9-8-10(6-7-15-9)13(16)11-4-2-3-5-12(11)14/h2-8H,1H3

InChI key: InChIKey=AUPINVBCUPGVDW-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C)N=CC1)C2=C(I)C=CC=C2

Synonyms:

• Methanone, (2-iodophenyl)(2-methyl-4-pyridinyl)-
• (2-Iodophenyl)(2-methyl-4-pyridinyl)methanone