CAS 1187169-62-5
:4-Isoquinolinyl[4-(1-methylethyl)phenyl]methanone
Description:
4-Isoquinolinyl[4-(1-methylethyl)phenyl]methanone, identified by its CAS number 1187169-62-5, is a chemical compound that features a complex structure incorporating an isoquinoline moiety and a ketone functional group. This compound typically exhibits characteristics common to organic molecules with aromatic systems, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of the isoquinoline ring suggests potential biological activity, as many isoquinoline derivatives are known for their pharmacological properties. The bulky isopropyl group attached to the phenyl ring may influence its solubility and reactivity, making it an interesting candidate for studies in medicinal chemistry or materials science. Additionally, the compound's molecular structure may allow for interactions with biological targets, which could be explored in drug development. Overall, 4-Isoquinolinyl[4-(1-methylethyl)phenyl]methanone represents a unique combination of structural features that could lead to diverse applications in research and industry.
Formula:C19H17NO
InChI:InChI=1S/C19H17NO/c1-13(2)14-7-9-15(10-8-14)19(21)18-12-20-11-16-5-3-4-6-17(16)18/h3-13H,1-2H3
InChI key:InChIKey=DTZDZGZGWZUDLT-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=CC=C(C(C)C)C=C3
Synonyms:- Methanone, 4-isoquinolinyl[4-(1-methylethyl)phenyl]-
- 4-Isoquinolinyl[4-(1-methylethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.