CAS 1187169-69-2
:(6-Chloro-3-pyridinyl)(3,4-difluorophenyl)methanone
Description:
(6-Chloro-3-pyridinyl)(3,4-difluorophenyl)methanone, identified by its CAS number 1187169-69-2, is a chemical compound characterized by its unique structural features. It consists of a pyridine ring substituted with a chlorine atom at the 6-position and a methanone group linked to a phenyl ring that has two fluorine atoms at the 3 and 4 positions. This compound exhibits properties typical of both heterocyclic and aromatic compounds, including potential biological activity due to the presence of the pyridine moiety, which is often associated with pharmacological properties. The difluorophenyl group may enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Additionally, the presence of halogens like chlorine and fluorine can affect the compound's stability, solubility, and overall chemical behavior. Such characteristics make it of interest in medicinal chemistry and material science, where it may serve as a lead compound for drug development or as an intermediate in synthetic pathways.
Formula:C12H6ClF2NO
InChI:InChI=1S/C12H6ClF2NO/c13-11-4-2-8(6-16-11)12(17)7-1-3-9(14)10(15)5-7/h1-6H
InChI key:InChIKey=ZMHAQASWMQOBOJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(F)C=C1)C=2C=CC(Cl)=NC2
Synonyms:- Methanone, (6-chloro-3-pyridinyl)(3,4-difluorophenyl)-
- (6-Chloro-3-pyridinyl)(3,4-difluorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.