CAS 1187169-70-5

(2,3-Dichlorophenyl)(2-methyl-4-pyridinyl)methanone

Description:

(2,3-Dichlorophenyl)(2-methyl-4-pyridinyl)methanone, identified by its CAS number 1187169-70-5, is a chemical compound characterized by its complex structure, which includes a dichlorophenyl group and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of chlorine atoms in the phenyl ring can influence its reactivity and solubility, while the pyridine ring may impart specific electronic characteristics. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular interactions of this compound can be influenced by its functional groups, making it a subject of interest in medicinal chemistry and material science. Additionally, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, (2,3-Dichlorophenyl)(2-methyl-4-pyridinyl)methanone represents a class of compounds with diverse applications and significant research interest.

Formula: C₁₃H₉Cl₂NO

InChI: InChI=1S/C13H9Cl2NO/c1-8-7-9(5-6-16-8)13(17)10-3-2-4-11(14)12(10)15/h2-7H,1H3

InChI key: InChIKey=ANHVXWSONQHKSE-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C(Cl)=CC=C1)C=2C=C(C)N=CC2

Synonyms:

• Methanone, (2,3-dichlorophenyl)(2-methyl-4-pyridinyl)-
• (2,3-Dichlorophenyl)(2-methyl-4-pyridinyl)methanone