CymitQuimica logo

CAS 1187169-78-3

:

(4-Heptylphenyl)-4-isoquinolinylmethanone

Description:
(4-Heptylphenyl)-4-isoquinolinylmethanone, identified by the CAS number 1187169-78-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a heptyl group, a phenyl ring, and an isoquinoline moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for π-π stacking interactions due to its conjugated system. It may display moderate to high lipophilicity due to the presence of the heptyl chain, influencing its solubility in organic solvents. The isoquinoline structure can impart biological activity, making this compound of interest in medicinal chemistry and material science. Its potential applications could range from pharmaceuticals to organic electronics, depending on its specific reactivity and interactions with other molecules. As with many organic compounds, its behavior in various environments, including thermal stability and reactivity with other chemical species, would be essential for understanding its practical uses and safety considerations.
Formula:C23H25NO
InChI:InChI=1S/C23H25NO/c1-2-3-4-5-6-9-18-12-14-19(15-13-18)23(25)22-17-24-16-20-10-7-8-11-21(20)22/h7-8,10-17H,2-6,9H2,1H3
InChI key:InChIKey=IQGCCVYUGWIKCU-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=CC=C(CCCCCCC)C=C3
Synonyms:
  • (4-Heptylphenyl)-4-isoquinolinylmethanone
  • Methanone, (4-heptylphenyl)-4-isoquinolinyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.