CAS 1187169-94-3

(2-Bromophenyl)(6-methyl-2-pyridinyl)methanone

Description:

(2-Bromophenyl)(6-methyl-2-pyridinyl)methanone, identified by its CAS number 1187169-94-3, is an organic compound characterized by its complex structure, which includes a bromophenyl group and a pyridinyl moiety. The presence of the bromine atom introduces significant polarity and can influence the compound's reactivity and solubility. The methyl group on the pyridine ring contributes to steric effects and may affect the compound's electronic properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can impact its behavior in biological systems and its potential applications in pharmaceuticals or agrochemicals. Additionally, the carbonyl functional group (ketone) in the structure can participate in various chemical reactions, such as nucleophilic additions. Overall, the unique combination of functional groups and structural features makes this compound of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₃H₁₀BrNO

InChI: InChI=1S/C13H10BrNO/c1-9-5-4-8-12(15-9)13(16)10-6-2-3-7-11(10)14/h2-8H,1H3

InChI key: InChIKey=AZBQUGLXXLEWPJ-UHFFFAOYSA-N

SMILES: C(=O)(C=1N=C(C)C=CC1)C2=C(Br)C=CC=C2

Synonyms:

• (2-Bromophenyl)(6-methyl-2-pyridinyl)methanone
• Methanone, (2-bromophenyl)(6-methyl-2-pyridinyl)-