CymitQuimica logo

CAS 1187169-97-6

:

(4-Ethoxyphenyl)(6-methyl-2-pyridinyl)methanone

Description:
(4-Ethoxyphenyl)(6-methyl-2-pyridinyl)methanone, identified by its CAS number 1187169-97-6, is an organic compound characterized by its unique molecular structure, which includes a phenyl group substituted with an ethoxy group and a pyridine moiety with a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The ethoxy group contributes to its solubility in organic solvents, while the pyridine ring may impart basicity and influence its interaction with other chemical species. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing more complex molecules. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound exemplifies the diversity of organic chemistry and the importance of functional group interactions in determining chemical behavior.
Formula:C15H15NO2
InChI:InChI=1S/C15H15NO2/c1-3-18-13-9-7-12(8-10-13)15(17)14-6-4-5-11(2)16-14/h4-10H,3H2,1-2H3
InChI key:InChIKey=OAFFVUCYCXTMSL-UHFFFAOYSA-N
SMILES:C(=O)(C=1N=C(C)C=CC1)C2=CC=C(OCC)C=C2
Synonyms:
  • Methanone, (4-ethoxyphenyl)(6-methyl-2-pyridinyl)-
  • (4-Ethoxyphenyl)(6-methyl-2-pyridinyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.