CymitQuimica logo

CAS 1187170-01-9

:

(2,3,4,5,6-Pentafluorophenyl)-3-quinolinylmethanone

Description:
(2,3,4,5,6-Pentafluorophenyl)-3-quinolinylmethanone is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a pentafluorophenyl group. The presence of five fluorine atoms on the phenyl ring significantly enhances the compound's lipophilicity and alters its electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The quinoline structure contributes to its aromaticity and may influence its biological activity. This compound is likely to exhibit high thermal stability and may be resistant to oxidation due to the fluorinated substituents. Additionally, the unique combination of functional groups may impart specific reactivity patterns, making it a candidate for further chemical modifications or as a building block in synthetic chemistry. Its CAS number, 1187170-01-9, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in scientific literature and databases.
Formula:C16H6F5NO
InChI:InChI=1S/C16H6F5NO/c17-11-10(12(18)14(20)15(21)13(11)19)16(23)8-5-7-3-1-2-4-9(7)22-6-8/h1-6H
InChI key:InChIKey=WZNVFLWKSVSLNZ-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(F)C(F)=C(F)C(F)=C1F)C2=CC3=C(N=C2)C=CC=C3
Synonyms:
  • Methanone, (2,3,4,5,6-pentafluorophenyl)-3-quinolinyl-
  • (2,3,4,5,6-Pentafluorophenyl)-3-quinolinylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.