CAS 1187170-10-0

(2-Methoxyphenyl)(5-methyl-2-pyridinyl)methanone

Description:

(2-Methoxyphenyl)(5-methyl-2-pyridinyl)methanone, identified by its CAS number 1187170-10-0, is an organic compound characterized by its unique structural features. It consists of a methanone functional group attached to a 2-methoxyphenyl group and a 5-methyl-2-pyridinyl moiety. This compound exhibits a combination of aromatic and heterocyclic characteristics, which can influence its chemical reactivity and interactions. The presence of the methoxy group enhances its solubility in organic solvents and may also affect its electronic properties, making it a potential candidate for various applications in medicinal chemistry and material science. Additionally, the pyridine ring contributes to the compound's basicity and potential coordination with metal ions. Overall, the structural complexity and functional groups present in (2-Methoxyphenyl)(5-methyl-2-pyridinyl)methanone suggest that it may possess interesting biological activities, warranting further investigation into its pharmacological properties and potential uses in drug development.

Formula: C₁₄H₁₃NO₂

InChI: InChI=1S/C14H13NO2/c1-10-7-8-12(15-9-10)14(16)11-5-3-4-6-13(11)17-2/h3-9H,1-2H3

InChI key: InChIKey=MVGCXZLVBVAMLJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C=CC=C1)C2=CC=C(C)C=N2

Synonyms:

• Methanone, (2-methoxyphenyl)(5-methyl-2-pyridinyl)-
• (2-Methoxyphenyl)(5-methyl-2-pyridinyl)methanone