CAS 1187170-20-2
:4-(6-Methyl-3-pyridinyl)benzonitrile
Description:
4-(6-Methyl-3-pyridinyl)benzonitrile, identified by its CAS number 1187170-20-2, is an organic compound characterized by its aromatic structure, which includes a benzonitrile moiety and a pyridine ring. The presence of the methyl group on the pyridine ring contributes to its unique chemical properties, influencing its reactivity and solubility. This compound typically exhibits a solid state at room temperature and is likely to be soluble in organic solvents due to its non-polar aromatic characteristics. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with pyridine and nitrile functionalities often exhibit biological activity. Additionally, the presence of the nitrile group may impart specific electronic properties, making it a candidate for various chemical reactions, including nucleophilic additions and cycloadditions. Overall, 4-(6-Methyl-3-pyridinyl)benzonitrile is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C13H10N2
InChI:InChI=1S/C13H10N2/c1-10-2-5-13(9-15-10)12-6-3-11(8-14)4-7-12/h2-7,9H,1H3
InChI key:InChIKey=TYQLXNKODYDCFO-UHFFFAOYSA-N
SMILES:C(#N)C1=CC=C(C=C1)C=2C=CC(C)=NC2
Synonyms:- 4-(6-Methyl-3-pyridinyl)benzonitrile
- Benzonitrile, 4-(6-methyl-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.