CAS 1187170-22-4

(4-Ethylphenyl)(5-methyl-2-pyridinyl)methanone

Description:

(4-Ethylphenyl)(5-methyl-2-pyridinyl)methanone, identified by its CAS number 1187170-22-4, is an organic compound characterized by its unique molecular structure, which includes a phenyl group substituted with an ethyl group and a pyridine ring with a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl functional group. It may display moderate solubility in organic solvents, influenced by its hydrophobic aromatic components. The presence of the pyridine ring suggests potential for coordination with metal ions, making it of interest in coordination chemistry. Additionally, the compound may possess biological activity, which could be explored in pharmaceutical applications. Its synthesis and reactivity can be influenced by the substituents on the aromatic rings, which can affect electronic distribution and steric hindrance. Overall, (4-Ethylphenyl)(5-methyl-2-pyridinyl)methanone represents a versatile structure with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₅H₁₅NO

InChI: InChI=1S/C15H15NO/c1-3-12-5-7-13(8-6-12)15(17)14-9-4-11(2)10-16-14/h4-10H,3H2,1-2H3

InChI key: InChIKey=JAFLFWDTZSMUJC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CC)C=C1)C2=CC=C(C)C=N2

Synonyms:

• Methanone, (4-ethylphenyl)(5-methyl-2-pyridinyl)-
• (4-Ethylphenyl)(5-methyl-2-pyridinyl)methanone