CymitQuimica logo

CAS 1187170-25-7

:

(5-Methyl-2-pyridinyl)(4-propylphenyl)methanone

Description:
(5-Methyl-2-pyridinyl)(4-propylphenyl)methanone, identified by its CAS number 1187170-25-7, is an organic compound characterized by its unique structure, which includes a pyridine ring and a propyl-substituted phenyl group attached to a ketone functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group. The methyl group on the pyridine ring can influence its electronic properties, potentially affecting its reactivity and interactions with other molecules. As a ketone, it may participate in various chemical reactions, including nucleophilic addition and condensation reactions. The presence of both the pyridine and phenyl groups suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound represents a versatile structure within organic chemistry, with implications for further research and application.
Formula:C16H17NO
InChI:InChI=1S/C16H17NO/c1-3-4-13-6-8-14(9-7-13)16(18)15-10-5-12(2)11-17-15/h5-11H,3-4H2,1-2H3
InChI key:InChIKey=ZUTUIJLPTGOVIF-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CCC)C=C1)C2=CC=C(C)C=N2
Synonyms:
  • (5-Methyl-2-pyridinyl)(4-propylphenyl)methanone
  • Methanone, (5-methyl-2-pyridinyl)(4-propylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.