CAS 1187170-29-1

(2-Methyl-4-pyridinyl)(4-phenoxyphenyl)methanone

Description:

(2-Methyl-4-pyridinyl)(4-phenoxyphenyl)methanone, identified by its CAS number 1187170-29-1, is an organic compound characterized by its complex molecular structure, which includes a pyridine ring and a phenyl ether moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. It may display moderate to high lipophilicity, influencing its solubility in organic solvents compared to water. The presence of the pyridine ring suggests potential basicity, while the phenoxy group can contribute to its electronic properties, possibly affecting its reactivity in various chemical reactions. This compound may be of interest in pharmaceutical research or materials science due to its unique structural features, which could impart specific biological activities or facilitate interactions in complex chemical environments. As with many organic compounds, its behavior in different conditions, such as temperature and pH, can significantly influence its stability and reactivity.

Formula: C₁₉H₁₅NO₂

InChI: InChI=1S/C19H15NO2/c1-14-13-16(11-12-20-14)19(21)15-7-9-18(10-8-15)22-17-5-3-2-4-6-17/h2-13H,1H3

InChI key: InChIKey=OPQRTOGFBMNHSN-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C)N=CC1)C2=CC=C(OC3=CC=CC=C3)C=C2

Synonyms:

• (2-Methyl-4-pyridinyl)(4-phenoxyphenyl)methanone
• Methanone, (2-methyl-4-pyridinyl)(4-phenoxyphenyl)-