CAS 1187170-31-5

Ethyl 5-(6-methyl-3-pyridinyl)-2-thiophenecarboxylate

Description:

Ethyl 5-(6-methyl-3-pyridinyl)-2-thiophenecarboxylate is an organic compound characterized by its unique structure, which includes a thiophene ring and a pyridine moiety. The presence of the ethyl ester functional group contributes to its solubility in organic solvents, making it useful in various chemical applications. This compound typically exhibits moderate to high stability under standard conditions, although it may be sensitive to light and moisture. Its molecular structure suggests potential biological activity, which could be explored in pharmaceutical research. The compound may also participate in various chemical reactions, such as esterification or nucleophilic substitutions, due to the reactive nature of the carboxylate group. Additionally, the presence of the methyl group on the pyridine ring can influence its electronic properties and reactivity. Overall, Ethyl 5-(6-methyl-3-pyridinyl)-2-thiophenecarboxylate is a versatile compound with potential applications in medicinal chemistry and organic synthesis.

Formula: C₁₃H₁₃NO₂S

InChI: InChI=1S/C13H13NO2S/c1-3-16-13(15)12-7-6-11(17-12)10-5-4-9(2)14-8-10/h4-8H,3H2,1-2H3

InChI key: InChIKey=UTOCDMXJSVKGMA-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC(=CC1)C=2C=CC(C)=NC2

Synonyms:

• Ethyl 5-(6-methyl-3-pyridinyl)-2-thiophenecarboxylate
• 2-Thiophenecarboxylic acid, 5-(6-methyl-3-pyridinyl)-, ethyl ester