CAS 1187170-38-2
:(3-Bromophenyl)(6-methyl-2-pyridinyl)methanone
Description:
(3-Bromophenyl)(6-methyl-2-pyridinyl)methanone, identified by its CAS number 1187170-38-2, is an organic compound characterized by its unique structure, which includes a bromophenyl group and a pyridinyl moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. The methyl group on the pyridine ring can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, (3-Bromophenyl)(6-methyl-2-pyridinyl)methanone represents a versatile building block in the synthesis of more complex organic molecules.
Formula:C13H10BrNO
InChI:InChI=1S/C13H10BrNO/c1-9-4-2-7-12(15-9)13(16)10-5-3-6-11(14)8-10/h2-8H,1H3
InChI key:InChIKey=KJYOTHTVVDAHIR-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Br)=CC=C1)C=2N=C(C)C=CC2
Synonyms:- (3-Bromophenyl)(6-methyl-2-pyridinyl)methanone
- Methanone, (3-bromophenyl)(6-methyl-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.