CAS 1187170-41-7

[4-(Hexyloxy)phenyl](4-methyl-2-pyridinyl)methanone

Description:

[4-(Hexyloxy)phenyl](4-methyl-2-pyridinyl)methanone, with the CAS number 1187170-41-7, is an organic compound characterized by its complex structure that includes a phenyl group substituted with a hexyloxy chain and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential solubility in organic solvents. The presence of the hexyloxy group enhances its hydrophobic characteristics, while the pyridinyl component may impart basicity and influence its reactivity. The methanone functional group suggests the presence of a carbonyl, which can participate in various chemical reactions, such as nucleophilic additions. This compound may be of interest in fields such as materials science, pharmaceuticals, or organic synthesis due to its unique structural features and potential biological activity. Its stability, reactivity, and interactions with other molecules would depend on the specific conditions and environments in which it is used.

Formula: C₁₉H₂₃NO₂

InChI: InChI=1S/C19H23NO2/c1-3-4-5-6-13-22-17-9-7-16(8-10-17)19(21)18-14-15(2)11-12-20-18/h7-12,14H,3-6,13H2,1-2H3

InChI key: InChIKey=YIKGXCVQYFCZNO-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OCCCCCC)C=C1)C2=CC(C)=CC=N2

Synonyms:

• Methanone, [4-(hexyloxy)phenyl](4-methyl-2-pyridinyl)-
• [4-(Hexyloxy)phenyl](4-methyl-2-pyridinyl)methanone

2-(4-Hexyloxybenzoyl)-4-methylpyridine

CAS: 1187170-41-7

Formula: C₁₉H₂₃NO₂

Purity: 97.0%

Molecular weight: 297.398

Ref: 10-F202949