CAS 1187170-44-0

(2,4-Difluorophenyl)(4-methyl-2-pyridinyl)methanone

Description:

(2,4-Difluorophenyl)(4-methyl-2-pyridinyl)methanone is an organic compound characterized by its complex structure, which includes a difluorophenyl group and a pyridinyl moiety. The presence of fluorine atoms in the phenyl ring enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The methanone functional group indicates that it contains a carbonyl group (C=O) adjacent to the aromatic systems, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the electronic effects of the attached groups. Additionally, the presence of the pyridine ring suggests potential interactions with biological targets, making it a candidate for studies in medicinal chemistry. Overall, the unique combination of functional groups in (2,4-Difluorophenyl)(4-methyl-2-pyridinyl)methanone contributes to its potential applications in drug development and other chemical syntheses.

Formula: C₁₃H₉F₂NO

InChI: InChI=1S/C13H9F2NO/c1-8-4-5-16-12(6-8)13(17)10-3-2-9(14)7-11(10)15/h2-7H,1H3

InChI key: InChIKey=IKVIEQWFBONHBP-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(F)C=C1)C2=CC(C)=CC=N2

Synonyms:

• (2,4-Difluorophenyl)(4-methyl-2-pyridinyl)methanone
• Methanone, (2,4-difluorophenyl)(4-methyl-2-pyridinyl)-