CAS 1187170-47-3

(6-Methyl-2-pyridinyl)(4-propoxyphenyl)methanone

Description:

(6-Methyl-2-pyridinyl)(4-propoxyphenyl)methanone, identified by its CAS number 1187170-47-3, is an organic compound characterized by its unique molecular structure, which includes a pyridine ring and a phenyl group substituted with a propoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse reactivity due to the presence of functional groups. The methyl group on the pyridine ring can influence its electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. The propoxy group on the phenyl ring may contribute to solubility in organic solvents and influence the compound's overall polarity. Such structural features suggest potential applications in pharmaceuticals or agrochemicals, where the compound may act as a ligand or a precursor in synthetic pathways. However, specific physical properties like melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.

Formula: C₁₆H₁₇NO₂

InChI: InChI=1S/C16H17NO2/c1-3-11-19-14-9-7-13(8-10-14)16(18)15-6-4-5-12(2)17-15/h4-10H,3,11H2,1-2H3

InChI key: InChIKey=LAWYNKLNGZFZTD-UHFFFAOYSA-N

SMILES: C(=O)(C=1N=C(C)C=CC1)C2=CC=C(OCCC)C=C2

Synonyms:

• (6-Methyl-2-pyridinyl)(4-propoxyphenyl)methanone
• Methanone, (6-methyl-2-pyridinyl)(4-propoxyphenyl)-