CAS 1187170-50-8

(6-Methyl-2-pyridinyl)[4-(pentyloxy)phenyl]methanone

Description:

(6-Methyl-2-pyridinyl)[4-(pentyloxy)phenyl]methanone, identified by its CAS number 1187170-50-8, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a pentyloxy chain. The presence of the methyl group on the pyridine ring contributes to its unique electronic properties, potentially influencing its reactivity and interaction with biological targets. The pentyloxy substituent enhances the lipophilicity of the molecule, which may affect its solubility and permeability in biological systems. This compound may exhibit interesting pharmacological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its properties can be studied using various analytical techniques such as NMR, mass spectrometry, and chromatography. Overall, the compound's unique combination of functional groups suggests potential applications in drug development or as a chemical probe in biological studies.

Formula: C₁₈H₂₁NO₂

InChI: InChI=1S/C18H21NO2/c1-3-4-5-13-21-16-11-9-15(10-12-16)18(20)17-8-6-7-14(2)19-17/h6-12H,3-5,13H2,1-2H3

InChI key: InChIKey=IPCSPPGAUNMOFF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OCCCCC)C=C1)C=2N=C(C)C=CC2

Synonyms:

• Methanone, (6-methyl-2-pyridinyl)[4-(pentyloxy)phenyl]-
• (6-Methyl-2-pyridinyl)[4-(pentyloxy)phenyl]methanone

6-Methyl-2-(4-pentyloxybenzoyl)pyridine

CAS: 1187170-50-8

Formula: C₁₈H₂₁NO₂

Purity: 97.0%

Molecular weight: 283.371

Ref: 10-F202812