CAS 1187170-51-9

(3-Methyl-2-pyridinyl)[3-(trifluoromethyl)phenyl]methanone

Description:

(3-Methyl-2-pyridinyl)[3-(trifluoromethyl)phenyl]methanone, identified by its CAS number 1187170-51-9, is an organic compound characterized by its complex structure, which includes a pyridine ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The trifluoromethyl group is known to enhance lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. The presence of the methyl group on the pyridine ring may also affect its electronic properties and steric hindrance. In terms of solubility, compounds of this nature often show varying degrees of solubility in polar and non-polar solvents, depending on their specific functional groups. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₄H₁₀F₃NO

InChI: InChI=1S/C14H10F3NO/c1-9-4-3-7-18-12(9)13(19)10-5-2-6-11(8-10)14(15,16)17/h2-8H,1H3

InChI key: InChIKey=CFHZKMBVAHGEER-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C(F)(F)F)=CC=C1)C2=C(C)C=CC=N2

Synonyms:

• Methanone, (3-methyl-2-pyridinyl)[3-(trifluoromethyl)phenyl]-
• (3-Methyl-2-pyridinyl)[3-(trifluoromethyl)phenyl]methanone