CAS 1187170-53-1
:[4-(Hexyloxy)phenyl](6-methyl-2-pyridinyl)methanone
Description:
[4-(Hexyloxy)phenyl](6-methyl-2-pyridinyl)methanone, identified by its CAS number 1187170-53-1, is an organic compound characterized by its complex molecular structure, which includes a phenyl group substituted with a hexyloxy chain and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse reactivity due to the presence of functional groups. The hexyloxy group enhances its solubility in organic solvents, while the pyridine ring contributes to its potential biological activity. The presence of the ketone functional group suggests that it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the compound may exhibit interesting optical properties due to its conjugated system, making it a candidate for applications in materials science or pharmaceuticals. Overall, its unique structure and functional groups suggest a range of potential applications in organic synthesis and medicinal chemistry.
Formula:C19H23NO2
InChI:InChI=1S/C19H23NO2/c1-3-4-5-6-14-22-17-12-10-16(11-13-17)19(21)18-9-7-8-15(2)20-18/h7-13H,3-6,14H2,1-2H3
InChI key:InChIKey=WSGWESQWGIELBM-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OCCCCCC)C=C1)C=2N=C(C)C=CC2
Synonyms:- [4-(Hexyloxy)phenyl](6-methyl-2-pyridinyl)methanone
- Methanone, [4-(hexyloxy)phenyl](6-methyl-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.