CAS 1187170-58-6
:(2,6-Difluorophenyl)(6-methyl-2-pyridinyl)methanone
Description:
(2,6-Difluorophenyl)(6-methyl-2-pyridinyl)methanone is an organic compound characterized by its complex structure, which includes a difluorophenyl group and a pyridinyl moiety. This compound features a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of fluorine atoms in the difluorophenyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The methyl group on the pyridine ring can also affect the electronic properties and steric hindrance of the molecule. Overall, this compound is likely to exhibit unique chemical properties, including potential interactions with biological targets, making it a candidate for further research in drug development or material science. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is studied.
Formula:C13H9F2NO
InChI:InChI=1S/C13H9F2NO/c1-8-4-2-7-11(16-8)13(17)12-9(14)5-3-6-10(12)15/h2-7H,1H3
InChI key:InChIKey=WAJMTJBEXIZEET-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(F)C=CC=C1F)C=2N=C(C)C=CC2
Synonyms:- Methanone, (2,6-difluorophenyl)(6-methyl-2-pyridinyl)-
- (2,6-Difluorophenyl)(6-methyl-2-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.