CAS 1187170-59-7

(2,5-Difluorophenyl)(6-methoxy-2-pyridinyl)methanone

Description:

(2,5-Difluorophenyl)(6-methoxy-2-pyridinyl)methanone, identified by its CAS number 1187170-59-7, is an organic compound characterized by its complex structure, which includes a difluorophenyl group and a methoxy-substituted pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic systems, contributing to its potential reactivity and interactions. The presence of fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The methoxy group can also affect the compound's electronic properties and solubility. As a ketone, it features a carbonyl functional group, which is known for its reactivity in various organic reactions, including nucleophilic additions. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₃H₉F₂NO₂

InChI: InChI=1S/C13H9F2NO2/c1-18-12-4-2-3-11(16-12)13(17)9-7-8(14)5-6-10(9)15/h2-7H,1H3

InChI key: InChIKey=LGKKCFHCUISDKP-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=CC(F)=C1)C=2N=C(OC)C=CC2

Synonyms:

• (2,5-Difluorophenyl)(6-methoxy-2-pyridinyl)methanone
• Methanone, (2,5-difluorophenyl)(6-methoxy-2-pyridinyl)-