CymitQuimica logo

CAS 1187170-63-3

:

(2,4-Difluorophenyl)(5-methyl-2-pyridinyl)methanone

Description:
(2,4-Difluorophenyl)(5-methyl-2-pyridinyl)methanone, identified by its CAS number 1187170-63-3, is a chemical compound characterized by its unique molecular structure, which includes a difluorophenyl group and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and stability. The presence of fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The ketone functional group in the structure suggests potential for reactivity in various organic reactions, such as nucleophilic additions. Additionally, the compound's molecular geometry and electronic properties can affect its interactions with biological targets, which is crucial for applications in drug design. Overall, (2,4-Difluorophenyl)(5-methyl-2-pyridinyl)methanone represents a class of compounds that may possess significant utility in medicinal chemistry and material science.
Formula:C13H9F2NO
InChI:InChI=1S/C13H9F2NO/c1-8-2-5-12(16-7-8)13(17)10-4-3-9(14)6-11(10)15/h2-7H,1H3
InChI key:InChIKey=UWGJUXPAXBOJHH-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(F)C=C(F)C=C1)C2=CC=C(C)C=N2
Synonyms:
  • Methanone, (2,4-difluorophenyl)(5-methyl-2-pyridinyl)-
  • (2,4-Difluorophenyl)(5-methyl-2-pyridinyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.